About 1,3,4-tritert-butylpyrrole
1,3,4-tritert-butylpyrrole (PubChem CID 24977707) has the molecular formula C16H29N
and a molecular weight of 235.41 g/mol. Its IUPAC name is 1,3,4-tritert-butylpyrrole.
Molecular Properties
| Compound Name | 1,3,4-tritert-butylpyrrole |
| PubChem CID | 24977707 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 1,3,4-tritert-butylpyrrole |
| SMILES | CC(C)(C)c1cn(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C16H29N/c1-14(2,3)12-10-17(16(7,8)9)11-13(12)15(4,5)6/h10-11H,1-9H3 |
| InChIKey | OJRHVDCSNCNQIG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3,4-tritert-butylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,4-tritert-butylpyrrole?
The IUPAC name of 1,3,4-tritert-butylpyrrole (CID 24977707) is 1,3,4-tritert-butylpyrrole.
What is the SMILES notation for 1,3,4-tritert-butylpyrrole?
The canonical SMILES for 1,3,4-tritert-butylpyrrole is CC(C)(C)c1cn(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of 1,3,4-tritert-butylpyrrole?
The InChIKey is OJRHVDCSNCNQIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N/c1-14(2,3)12-10-17(16(7,8)9)11-13(12)15(4,5)6/h10-11H,1-9H3.
What are the key properties of 1,3,4-tritert-butylpyrrole?
1,3,4-tritert-butylpyrrole has a molecular weight of 235.41 g/mol, XLogP of 4.84, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,4-tritert-butylpyrrole is sourced from PubChem (CID 24977707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).