About (3E,5Z)-N,N-dimethylhepta-3,5-dienamide
(3E,5Z)-N,N-dimethylhepta-3,5-dienamide (PubChem CID 24977731) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is (3E,5Z)-N,N-dimethylhepta-3,5-dienamide.
Molecular Properties
| Compound Name | (3E,5Z)-N,N-dimethylhepta-3,5-dienamide |
| PubChem CID | 24977731 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (3E,5Z)-N,N-dimethylhepta-3,5-dienamide |
| SMILES | C/C=C\C=C\CC(=O)N(C)C |
| InChI | InChI=1S/C9H15NO/c1-4-5-6-7-8-9(11)10(2)3/h4-7H,8H2,1-3H3/b5-4-,7-6+ |
| InChIKey | MPMGRQSCKFZWMR-SCFJQAPRSA-N |
| XLogP | 1.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-N,N-dimethylhepta-3,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-N,N-dimethylhepta-3,5-dienamide?
The IUPAC name of (3E,5Z)-N,N-dimethylhepta-3,5-dienamide (CID 24977731) is (3E,5Z)-N,N-dimethylhepta-3,5-dienamide.
What is the SMILES notation for (3E,5Z)-N,N-dimethylhepta-3,5-dienamide?
The canonical SMILES for (3E,5Z)-N,N-dimethylhepta-3,5-dienamide is C/C=C\C=C\CC(=O)N(C)C.
What is the InChIKey of (3E,5Z)-N,N-dimethylhepta-3,5-dienamide?
The InChIKey is MPMGRQSCKFZWMR-SCFJQAPRSA-N. The full InChI is InChI=1S/C9H15NO/c1-4-5-6-7-8-9(11)10(2)3/h4-7H,8H2,1-3H3/b5-4-,7-6+.
What are the key properties of (3E,5Z)-N,N-dimethylhepta-3,5-dienamide?
(3E,5Z)-N,N-dimethylhepta-3,5-dienamide has a molecular weight of 153.22 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-N,N-dimethylhepta-3,5-dienamide is sourced from PubChem (CID 24977731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).