C28H25N3O4 — CID 24978491
cis-(1R,2S)-2-N-hydroxy-1-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1,2-dicarboxamide (PubChem CID 24978491) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is cis-(1R,2S)-2-N-hydroxy-1-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | cis-(1R,2S)-2-N-hydroxy-1-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 24978491 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | cis-(1R,2S)-2-N-hydroxy-1-[[4-[(2-phenylquinolin-4-yl)methoxy]phenyl]methyl]cyclopropane-1,2-dicarboxamide |
| SMILES | NC(=O)[C@@]1(Cc2ccc(OCc3cc(-c4ccccc4)nc4ccccc34)cc2)C[C@@H]1C(=O)NO |
| InChI | InChI=1S/C28H25N3O4/c29-27(33)28(16-23(28)26(32)31-34)15-18-10-12-21(13-11-18)35-17-20-14-25(19-6-2-1-3-7-19)30-24-9-5-4-8-22(20)24/h1-14,23,34H,15-17H2,(H2,29,33)(H,31,32)/t23-,28+/m1/s1 |
| InChIKey | BKHGWMSYWJIRLD-LXFBAYGMSA-N |
| XLogP | 4.02 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|