About (2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate
(2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 24978677) has the molecular formula C19H19NO5S
and a molecular weight of 373.43 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate.
Molecular Properties
| Compound Name | (2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| PubChem CID | 24978677 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | (2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | COc1cccc(COC(=O)c2ccc3c(c2)NC(=O)C(C)S3)c1OC |
| InChI | InChI=1S/C19H19NO5S/c1-11-18(21)20-14-9-12(7-8-16(14)26-11)19(22)25-10-13-5-4-6-15(23-2)17(13)24-3/h4-9,11H,10H2,1-3H3,(H,20,21) |
| InChIKey | JLVQXIGEKIMEOQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate?
The IUPAC name of (2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate (CID 24978677) is (2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate.
What is the SMILES notation for (2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate?
The canonical SMILES for (2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate is COc1cccc(COC(=O)c2ccc3c(c2)NC(=O)C(C)S3)c1OC.
What is the InChIKey of (2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate?
The InChIKey is JLVQXIGEKIMEOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO5S/c1-11-18(21)20-14-9-12(7-8-16(14)26-11)19(22)25-10-13-5-4-6-15(23-2)17(13)24-3/h4-9,11H,10H2,1-3H3,(H,20,21).
What are the key properties of (2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate?
(2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate has a molecular weight of 373.43 g/mol, XLogP of 3.49, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethoxyphenyl)methyl 2-methyl-3-oxo-4H-1,4-benzothiazine-6-carboxylate is sourced from PubChem (CID 24978677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).