About [1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate
[1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate (PubChem CID 24978779) has the molecular formula C20H23NO3S
and a molecular weight of 357.48 g/mol. Its IUPAC name is [1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate.
Molecular Properties
| Compound Name | [1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate |
| PubChem CID | 24978779 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate |
| SMILES | Cc1ccc(SCC(=O)OC(C)C(=O)NCc2ccccc2)cc1C |
| InChI | InChI=1S/C20H23NO3S/c1-14-9-10-18(11-15(14)2)25-13-19(22)24-16(3)20(23)21-12-17-7-5-4-6-8-17/h4-11,16H,12-13H2,1-3H3,(H,21,23) |
| InChIKey | LFYKBWDUAUKYJR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate?
The IUPAC name of [1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate (CID 24978779) is [1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate.
What is the SMILES notation for [1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate?
The canonical SMILES for [1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate is Cc1ccc(SCC(=O)OC(C)C(=O)NCc2ccccc2)cc1C.
What is the InChIKey of [1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate?
The InChIKey is LFYKBWDUAUKYJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO3S/c1-14-9-10-18(11-15(14)2)25-13-19(22)24-16(3)20(23)21-12-17-7-5-4-6-8-17/h4-11,16H,12-13H2,1-3H3,(H,21,23).
What are the key properties of [1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate?
[1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate has a molecular weight of 357.48 g/mol, XLogP of 3.64, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(benzylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenyl)sulfanylacetate is sourced from PubChem (CID 24978779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).