C22H23N3O6 — CID 24978794
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N'-[2-(4-methoxyphenoxy)acetyl]benzohydrazide (PubChem CID 24978794) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N'-[2-(4-methoxyphenoxy)acetyl]benzohydrazide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N'-[2-(4-methoxyphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 24978794 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N'-[2-(4-methoxyphenoxy)acetyl]benzohydrazide |
| SMILES | COc1ccc(OCC(=O)NNC(=O)c2ccccc2OCc2c(C)noc2C)cc1 |
| InChI | InChI=1S/C22H23N3O6/c1-14-19(15(2)31-25-14)12-30-20-7-5-4-6-18(20)22(27)24-23-21(26)13-29-17-10-8-16(28-3)9-11-17/h4-11H,12-13H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | RKMUUEFOWFBGHE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|