C23H24F3N3O3 — CID 24978881
1-benzyl-5-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpyrrolidine-3-carboxamide (PubChem CID 24978881) has the molecular formula C23H24F3N3O3 and a molecular weight of 447.46 g/mol. Its IUPAC name is 1-benzyl-5-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpyrrolidine-3-carboxamide.
| Compound Name | 1-benzyl-5-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 24978881 |
| Molecular Formula | C23H24F3N3O3 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 1-benzyl-5-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylpyrrolidine-3-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)C1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H24F3N3O3/c1-2-10-28(14-19(30)27-18-9-8-17(24)21(25)22(18)26)23(32)16-11-20(31)29(13-16)12-15-6-4-3-5-7-15/h3-9,16H,2,10-14H2,1H3,(H,27,30) |
| InChIKey | CDDHVWKRTPIKBD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|