C16H17N3O6 — CID 24979102
(2-benzamido-2-oxoethyl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 24979102) has the molecular formula C16H17N3O6 and a molecular weight of 347.33 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | (2-benzamido-2-oxoethyl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 24979102 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CC1(C)NC(=O)N(CC(=O)OCC(=O)NC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C16H17N3O6/c1-16(2)14(23)19(15(24)18-16)8-12(21)25-9-11(20)17-13(22)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H,18,24)(H,17,20,22) |
| InChIKey | GDKDVPCTJLIRBM-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|