C18H14Cl2N6O4 — CID 24979164
N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 24979164) has the molecular formula C18H14Cl2N6O4 and a molecular weight of 449.25 g/mol. Its IUPAC name is N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 24979164 |
| Molecular Formula | C18H14Cl2N6O4 |
| Molecular Weight | 449.25 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methyl-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14Cl2N6O4/c1-24(8-16(27)23-17-12(19)3-2-4-13(17)20)18(28)11-5-6-14(15(7-11)26(29)30)25-10-21-9-22-25/h2-7,9-10H,8H2,1H3,(H,23,27) |
| InChIKey | XJIXEVZXKCPJIO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|