About [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate
[1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (PubChem CID 24979194) has the molecular formula C20H22N4O6
and a molecular weight of 414.42 g/mol. Its IUPAC name is [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
Molecular Properties
| Compound Name | [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| PubChem CID | 24979194 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| SMILES | CCOc1ccc(C(=O)C(C)OC(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C20H22N4O6/c1-5-29-14-8-6-13(7-9-14)17(26)12(2)30-15(25)10-24-11-21-18-16(24)19(27)23(4)20(28)22(18)3/h6-9,11-12H,5,10H2,1-4H3 |
| InChIKey | UOAGINRGSLQWNS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 114.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate?
The IUPAC name of [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (CID 24979194) is [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
What is the SMILES notation for [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate?
The canonical SMILES for [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate is CCOc1ccc(C(=O)C(C)OC(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)cc1.
What is the InChIKey of [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate?
The InChIKey is UOAGINRGSLQWNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O6/c1-5-29-14-8-6-13(7-9-14)17(26)12(2)30-15(25)10-24-11-21-18-16(24)19(27)23(4)20(28)22(18)3/h6-9,11-12H,5,10H2,1-4H3.
What are the key properties of [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate?
[1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate has a molecular weight of 414.42 g/mol, XLogP of 0.65, 7 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-ethoxyphenyl)-1-oxopropan-2-yl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate is sourced from PubChem (CID 24979194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).