C18H22FN3O5S — CID 24979222
N-(1,1-dioxothiolan-3-yl)-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-methylacetamide (PubChem CID 24979222) has the molecular formula C18H22FN3O5S and a molecular weight of 411.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-methylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 24979222 |
| Molecular Formula | C18H22FN3O5S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-methylacetamide |
| SMILES | CCC1(c2ccc(F)cc2)NC(=O)N(CC(=O)N(C)C2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C18H22FN3O5S/c1-3-18(12-4-6-13(19)7-5-12)16(24)22(17(25)20-18)10-15(23)21(2)14-8-9-28(26,27)11-14/h4-7,14H,3,8-11H2,1-2H3,(H,20,25) |
| InChIKey | NRWBMARIVNILOW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|