About [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate
[2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate (PubChem CID 24979552) has the molecular formula C21H23NO4
and a molecular weight of 353.42 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate.
Molecular Properties
| Compound Name | [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate |
| PubChem CID | 24979552 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)CNC(=O)c2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C21H23NO4/c1-13-9-15(3)20(16(4)10-13)18(23)12-26-19(24)11-22-21(25)17-8-6-5-7-14(17)2/h5-10H,11-12H2,1-4H3,(H,22,25) |
| InChIKey | GCPWTHVQOSYUED-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate?
The IUPAC name of [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate (CID 24979552) is [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate.
What is the SMILES notation for [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate?
The canonical SMILES for [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate is Cc1cc(C)c(C(=O)COC(=O)CNC(=O)c2ccccc2C)c(C)c1.
What is the InChIKey of [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate?
The InChIKey is GCPWTHVQOSYUED-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO4/c1-13-9-15(3)20(16(4)10-13)18(23)12-26-19(24)11-22-21(25)17-8-6-5-7-14(17)2/h5-10H,11-12H2,1-4H3,(H,22,25).
What are the key properties of [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate?
[2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate has a molecular weight of 353.42 g/mol, XLogP of 3.08, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 2-[(2-methylbenzoyl)amino]acetate is sourced from PubChem (CID 24979552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).