C16H12Cl2N4 — CID 24979614
2,6-dichloro-4-(3,4-dihydropyrazino[1,2-b]indazol-1-yl)aniline (PubChem CID 24979614) has the molecular formula C16H12Cl2N4 and a molecular weight of 331.21 g/mol. Its IUPAC name is 2,6-dichloro-4-(3,4-dihydropyrazino[1,2-b]indazol-1-yl)aniline.
| Compound Name | 2,6-dichloro-4-(3,4-dihydropyrazino[1,2-b]indazol-1-yl)aniline |
|---|---|
| PubChem CID | 24979614 |
| Molecular Formula | C16H12Cl2N4 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2,6-dichloro-4-(3,4-dihydropyrazino[1,2-b]indazol-1-yl)aniline |
| SMILES | Nc1c(Cl)cc(C2=NCCn3nc4ccccc4c32)cc1Cl |
| InChI | InChI=1S/C16H12Cl2N4/c17-11-7-9(8-12(18)14(11)19)15-16-10-3-1-2-4-13(10)21-22(16)6-5-20-15/h1-4,7-8H,5-6,19H2 |
| InChIKey | QPHCYMCCARYUNH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|