C21H19F6N3O4 — CID 24979709
3-[3-(4-methylbenzoyl)-1-oxido-6-(trifluoromethyl)indazol-1-ium-2-yl]propylazanium;2,2,2-trifluoroacetate (PubChem CID 24979709) has the molecular formula C21H19F6N3O4 and a molecular weight of 491.39 g/mol. Its IUPAC name is 3-[3-(4-methylbenzoyl)-1-oxido-6-(trifluoromethyl)indazol-1-ium-2-yl]propylazanium;2,2,2-trifluoroacetate.
| Compound Name | 3-[3-(4-methylbenzoyl)-1-oxido-6-(trifluoromethyl)indazol-1-ium-2-yl]propylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 24979709 |
| Molecular Formula | C21H19F6N3O4 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 3-[3-(4-methylbenzoyl)-1-oxido-6-(trifluoromethyl)indazol-1-ium-2-yl]propylazanium;2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(C(=O)c2c3ccc(C(F)(F)F)cc3[n+]([O-])n2CCC[NH3+])cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C19H18F3N3O2.C2HF3O2/c1-12-3-5-13(6-4-12)18(26)17-15-8-7-14(19(20,21)22)11-16(15)25(27)24(17)10-2-9-23;3-2(4,5)1(6)7/h3-8,11H,2,9-10,23H2,1H3;(H,6,7) |
| InChIKey | REPPMGNLKIMKOI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|