C19H18ClN3O4 — CID 24979713
4-[3-(4-chlorobenzoyl)-6-methoxy-1-oxidoindazol-1-ium-2-yl]butanamide (PubChem CID 24979713) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is 4-[3-(4-chlorobenzoyl)-6-methoxy-1-oxidoindazol-1-ium-2-yl]butanamide.
| Compound Name | 4-[3-(4-chlorobenzoyl)-6-methoxy-1-oxidoindazol-1-ium-2-yl]butanamide |
|---|---|
| PubChem CID | 24979713 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 4-[3-(4-chlorobenzoyl)-6-methoxy-1-oxidoindazol-1-ium-2-yl]butanamide |
| SMILES | COc1ccc2c(C(=O)c3ccc(Cl)cc3)n(CCCC(N)=O)[n+]([O-])c2c1 |
| InChI | InChI=1S/C19H18ClN3O4/c1-27-14-8-9-15-16(11-14)23(26)22(10-2-3-17(21)24)18(15)19(25)12-4-6-13(20)7-5-12/h4-9,11H,2-3,10H2,1H3,(H2,21,24) |
| InChIKey | RPRZXWDKYYUWJH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|