C16H11Cl2N5O3 — CID 24979714
2,6-dichloro-4-(8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium-1-yl)aniline (PubChem CID 24979714) has the molecular formula C16H11Cl2N5O3 and a molecular weight of 392.20 g/mol. Its IUPAC name is 2,6-dichloro-4-(8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium-1-yl)aniline.
| Compound Name | 2,6-dichloro-4-(8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium-1-yl)aniline |
|---|---|
| PubChem CID | 24979714 |
| Molecular Formula | C16H11Cl2N5O3 |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 2,6-dichloro-4-(8-nitro-6-oxido-3,4-dihydropyrazino[1,2-b]indazol-6-ium-1-yl)aniline |
| SMILES | Nc1c(Cl)cc(C2=NCCn3c2c2ccc([N+](=O)[O-])cc2[n+]3[O-])cc1Cl |
| InChI | InChI=1S/C16H11Cl2N5O3/c17-11-5-8(6-12(18)14(11)19)15-16-10-2-1-9(23(25)26)7-13(10)22(24)21(16)4-3-20-15/h1-2,5-7H,3-4,19H2 |
| InChIKey | CYDKLXARROVKQA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|