C26H27NO5 — CID 24979721
2-(4-benzoylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylacetamide (PubChem CID 24979721) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is 2-(4-benzoylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylacetamide.
| Compound Name | 2-(4-benzoylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 24979721 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-(4-benzoylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylacetamide |
| SMILES | COc1ccc(CCN(C)C(=O)COc2ccc(C(=O)c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C26H27NO5/c1-27(16-15-19-9-14-23(30-2)24(17-19)31-3)25(28)18-32-22-12-10-21(11-13-22)26(29)20-7-5-4-6-8-20/h4-14,17H,15-16,18H2,1-3H3 |
| InChIKey | GCCURGLWBSKABZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |