C17H11Cl2F3N4O — CID 24979730
2,6-dichloro-4-[6-oxido-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazol-6-ium-1-yl]aniline (PubChem CID 24979730) has the molecular formula C17H11Cl2F3N4O and a molecular weight of 415.20 g/mol. Its IUPAC name is 2,6-dichloro-4-[6-oxido-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazol-6-ium-1-yl]aniline.
| Compound Name | 2,6-dichloro-4-[6-oxido-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazol-6-ium-1-yl]aniline |
|---|---|
| PubChem CID | 24979730 |
| Molecular Formula | C17H11Cl2F3N4O |
| Molecular Weight | 415.20 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 2,6-dichloro-4-[6-oxido-8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazol-6-ium-1-yl]aniline |
| SMILES | Nc1c(Cl)cc(C2=NCCn3c2c2ccc(C(F)(F)F)cc2[n+]3[O-])cc1Cl |
| InChI | InChI=1S/C17H11Cl2F3N4O/c18-11-5-8(6-12(19)14(11)23)15-16-10-2-1-9(17(20,21)22)7-13(10)26(27)25(16)4-3-24-15/h1-2,5-7H,3-4,23H2 |
| InChIKey | JKMKGHBSANYJIS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.20 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|