About 4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide
4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide (PubChem CID 24980064) has the molecular formula C25H33N3O2
and a molecular weight of 407.56 g/mol. Its IUPAC name is 4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide |
| PubChem CID | 24980064 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide |
| SMILES | CN(Cc1ccc(C(C)(C)C)cc1)C(=O)C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C25H33N3O2/c1-25(2,3)21-12-10-19(11-13-21)18-27(4)23(29)20-14-16-28(17-15-20)24(30)26-22-8-6-5-7-9-22/h5-13,20H,14-18H2,1-4H3,(H,26,30) |
| InChIKey | RIBCMMSGQSEOTM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide?
The IUPAC name of 4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide (CID 24980064) is 4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide.
What is the SMILES notation for 4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide?
The canonical SMILES for 4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide is CN(Cc1ccc(C(C)(C)C)cc1)C(=O)C1CCN(C(=O)Nc2ccccc2)CC1.
What is the InChIKey of 4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide?
The InChIKey is RIBCMMSGQSEOTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33N3O2/c1-25(2,3)21-12-10-19(11-13-21)18-27(4)23(29)20-14-16-28(17-15-20)24(30)26-22-8-6-5-7-9-22/h5-13,20H,14-18H2,1-4H3,(H,26,30).
What are the key properties of 4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide?
4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide has a molecular weight of 407.56 g/mol, XLogP of 4.89, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[(4-tert-butylphenyl)methyl]-4-N-methyl-1-N-phenylpiperidine-1,4-dicarboxamide is sourced from PubChem (CID 24980064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).