About [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 24980110) has the molecular formula C14H9ClF3N3O3
and a molecular weight of 359.69 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate |
| PubChem CID | 24980110 |
| Molecular Formula | C14H9ClF3N3O3 |
| Molecular Weight | 359.69 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | O=C(COC(=O)c1cnccn1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C14H9ClF3N3O3/c15-8-1-2-10(9(5-8)14(16,17)18)21-12(22)7-24-13(23)11-6-19-3-4-20-11/h1-6H,7H2,(H,21,22) |
| InChIKey | QYRYRLHJNXUMML-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.69 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate?
The IUPAC name of [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate (CID 24980110) is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate.
What is the SMILES notation for [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate?
The canonical SMILES for [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate is O=C(COC(=O)c1cnccn1)Nc1ccc(Cl)cc1C(F)(F)F.
What is the InChIKey of [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate?
The InChIKey is QYRYRLHJNXUMML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClF3N3O3/c15-8-1-2-10(9(5-8)14(16,17)18)21-12(22)7-24-13(23)11-6-19-3-4-20-11/h1-6H,7H2,(H,21,22).
What are the key properties of [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate?
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate has a molecular weight of 359.69 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] pyrazine-2-carboxylate is sourced from PubChem (CID 24980110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).