C26H36N6O4 — CID 24980112
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)-4-oxo-3-pentylphthalazine-1-carboxamide (PubChem CID 24980112) has the molecular formula C26H36N6O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)-4-oxo-3-pentylphthalazine-1-carboxamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)-4-oxo-3-pentylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 24980112 |
| Molecular Formula | C26H36N6O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)-4-oxo-3-pentylphthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)N(CC(C)C)c2c(N)n(CCCC)c(=O)[nH]c2=O)c2ccccc2c1=O |
| InChI | InChI=1S/C26H36N6O4/c1-5-7-11-15-32-24(34)19-13-10-9-12-18(19)20(29-32)25(35)31(16-17(3)4)21-22(27)30(14-8-6-2)26(36)28-23(21)33/h9-10,12-13,17H,5-8,11,14-16,27H2,1-4H3,(H,28,33,36) |
| InChIKey | XAYAOHXESDWJBJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|