About N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide (PubChem CID 24980160) has the molecular formula C19H15ClN6O2
and a molecular weight of 394.82 g/mol. Its IUPAC name is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide.
Molecular Properties
| Compound Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide |
| PubChem CID | 24980160 |
| Molecular Formula | C19H15ClN6O2 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide |
| SMILES | CCn1nc(C(=O)Nc2cc(Cl)ccc2-n2cncn2)c2ccccc2c1=O |
| InChI | InChI=1S/C19H15ClN6O2/c1-2-25-19(28)14-6-4-3-5-13(14)17(24-25)18(27)23-15-9-12(20)7-8-16(15)26-11-21-10-22-26/h3-11H,2H2,1H3,(H,23,27) |
| InChIKey | IVBTYYPWYBJGNW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide?
The IUPAC name of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide (CID 24980160) is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide.
What is the SMILES notation for N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide?
The canonical SMILES for N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide is CCn1nc(C(=O)Nc2cc(Cl)ccc2-n2cncn2)c2ccccc2c1=O.
What is the InChIKey of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide?
The InChIKey is IVBTYYPWYBJGNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClN6O2/c1-2-25-19(28)14-6-4-3-5-13(14)17(24-25)18(27)23-15-9-12(20)7-8-16(15)26-11-21-10-22-26/h3-11H,2H2,1H3,(H,23,27).
What are the key properties of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide?
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide has a molecular weight of 394.82 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3-ethyl-4-oxophthalazine-1-carboxamide is sourced from PubChem (CID 24980160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).