About (2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate
(2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 24980312) has the molecular formula C22H27NO6S
and a molecular weight of 433.53 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate.
Molecular Properties
| Compound Name | (2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
| PubChem CID | 24980312 |
| Molecular Formula | C22H27NO6S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | (2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | COc1cccc(COC(=O)c2ccc(S(=O)(=O)N3CCC(C)CC3)cc2)c1OC |
| InChI | InChI=1S/C22H27NO6S/c1-16-11-13-23(14-12-16)30(25,26)19-9-7-17(8-10-19)22(24)29-15-18-5-4-6-20(27-2)21(18)28-3/h4-10,16H,11-15H2,1-3H3 |
| InChIKey | VPBPJSKJQOMYFT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate?
The IUPAC name of (2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate (CID 24980312) is (2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate.
What is the SMILES notation for (2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate?
The canonical SMILES for (2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate is COc1cccc(COC(=O)c2ccc(S(=O)(=O)N3CCC(C)CC3)cc2)c1OC.
What is the InChIKey of (2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate?
The InChIKey is VPBPJSKJQOMYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO6S/c1-16-11-13-23(14-12-16)30(25,26)19-9-7-17(8-10-19)22(24)29-15-18-5-4-6-20(27-2)21(18)28-3/h4-10,16H,11-15H2,1-3H3.
What are the key properties of (2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate?
(2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate has a molecular weight of 433.53 g/mol, XLogP of 3.48, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethoxyphenyl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate is sourced from PubChem (CID 24980312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).