About azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone
azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone (PubChem CID 24980373) has the molecular formula C19H26Cl2N2O3S
and a molecular weight of 433.40 g/mol. Its IUPAC name is azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone.
Molecular Properties
| Compound Name | azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone |
| PubChem CID | 24980373 |
| Molecular Formula | C19H26Cl2N2O3S |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1)N1CCCCCCC1 |
| InChI | InChI=1S/C19H26Cl2N2O3S/c20-16-7-6-8-17(21)18(16)27(25,26)23-13-9-15(10-14-23)19(24)22-11-4-2-1-3-5-12-22/h6-8,15H,1-5,9-14H2 |
| InChIKey | AZJWBKOOODJTBL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone?
The IUPAC name of azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone (CID 24980373) is azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone.
What is the SMILES notation for azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone?
The canonical SMILES for azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone is O=C(C1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1)N1CCCCCCC1.
What is the InChIKey of azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone?
The InChIKey is AZJWBKOOODJTBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26Cl2N2O3S/c20-16-7-6-8-17(21)18(16)27(25,26)23-13-9-15(10-14-23)19(24)22-11-4-2-1-3-5-12-22/h6-8,15H,1-5,9-14H2.
What are the key properties of azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone?
azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone has a molecular weight of 433.40 g/mol, XLogP of 4.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azocan-1-yl-[1-(2,6-dichlorophenyl)sulfonylpiperidin-4-yl]methanone is sourced from PubChem (CID 24980373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).