C19H21N3O4S — CID 24980390
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)acetamide (PubChem CID 24980390) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 24980390 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CCOc1ccc2nc(NC(=O)CN3C(=O)C4CCCCC4C3=O)sc2c1 |
| InChI | InChI=1S/C19H21N3O4S/c1-2-26-11-7-8-14-15(9-11)27-19(20-14)21-16(23)10-22-17(24)12-5-3-4-6-13(12)18(22)25/h7-9,12-13H,2-6,10H2,1H3,(H,20,21,23) |
| InChIKey | XSFURZOKOSZRHN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|