C24H26N4O4 — CID 24980475
N-(2-methoxyethyl)-1-[[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-5-phenylpyrazole-3-carboxamide (PubChem CID 24980475) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-[[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-5-phenylpyrazole-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-[[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-5-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 24980475 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-(2-methoxyethyl)-1-[[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-5-phenylpyrazole-3-carboxamide |
| SMILES | COCCNC(=O)c1cc(-c2ccccc2)n(CC2CC(c3ccc(OC)cc3)=NO2)n1 |
| InChI | InChI=1S/C24H26N4O4/c1-30-13-12-25-24(29)22-15-23(18-6-4-3-5-7-18)28(26-22)16-20-14-21(27-32-20)17-8-10-19(31-2)11-9-17/h3-11,15,20H,12-14,16H2,1-2H3,(H,25,29) |
| InChIKey | JAFBRFLGXQYFIY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|