C21H23N3O3S — CID 24980527
3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-N-(2-phenoxyethyl)propanamide (PubChem CID 24980527) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-N-(2-phenoxyethyl)propanamide.
| Compound Name | 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-N-(2-phenoxyethyl)propanamide |
|---|---|
| PubChem CID | 24980527 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-N-(2-phenoxyethyl)propanamide |
| SMILES | O=C(CCc1nc2sc3c(c2c(=O)[nH]1)CCCC3)NCCOc1ccccc1 |
| InChI | InChI=1S/C21H23N3O3S/c25-18(22-12-13-27-14-6-2-1-3-7-14)11-10-17-23-20(26)19-15-8-4-5-9-16(15)28-21(19)24-17/h1-3,6-7H,4-5,8-13H2,(H,22,25)(H,23,24,26) |
| InChIKey | NLXNMQPKHRUAOR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|