About N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide
N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 24980595) has the molecular formula C20H29N3O5S
and a molecular weight of 423.54 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 24980595 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCc1noc(C)c1C(=O)Nc1cc(S(=O)(=O)N(CC)CC)ccc1OC(C)C |
| InChI | InChI=1S/C20H29N3O5S/c1-7-16-19(14(6)28-22-16)20(24)21-17-12-15(10-11-18(17)27-13(4)5)29(25,26)23(8-2)9-3/h10-13H,7-9H2,1-6H3,(H,21,24) |
| InChIKey | OZVHDAZEKXGBCT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide?
The IUPAC name of N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide (CID 24980595) is N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide is CCc1noc(C)c1C(=O)Nc1cc(S(=O)(=O)N(CC)CC)ccc1OC(C)C.
What is the InChIKey of N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide?
The InChIKey is OZVHDAZEKXGBCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N3O5S/c1-7-16-19(14(6)28-22-16)20(24)21-17-12-15(10-11-18(17)27-13(4)5)29(25,26)23(8-2)9-3/h10-13H,7-9H2,1-6H3,(H,21,24).
What are the key properties of N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide?
N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide has a molecular weight of 423.54 g/mol, XLogP of 3.62, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]-3-ethyl-5-methyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 24980595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).