C19H22O4S — CID 24980822
(2,5-dimethylphenyl)methyl 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 24980822) has the molecular formula C19H22O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl 3-(4-methylphenyl)sulfonylpropanoate.
| Compound Name | (2,5-dimethylphenyl)methyl 3-(4-methylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 24980822 |
| Molecular Formula | C19H22O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (2,5-dimethylphenyl)methyl 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)OCc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C19H22O4S/c1-14-5-8-18(9-6-14)24(21,22)11-10-19(20)23-13-17-12-15(2)4-7-16(17)3/h4-9,12H,10-11,13H2,1-3H3 |
| InChIKey | MZMZMNJSUKPJIR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |