C15H18N4O3 — CID 24981032
2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(6-methyl-2-pyridinyl)acetamide (PubChem CID 24981032) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(6-methyl-2-pyridinyl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(6-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 24981032 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(6-methyl-2-pyridinyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)NC3(CCCC3)C2=O)n1 |
| InChI | InChI=1S/C15H18N4O3/c1-10-5-4-6-11(16-10)17-12(20)9-19-13(21)15(18-14(19)22)7-2-3-8-15/h4-6H,2-3,7-9H2,1H3,(H,18,22)(H,16,17,20) |
| InChIKey | SNYCVFNCHSTMME-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|