About N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide
N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide (PubChem CID 24981267) has the molecular formula C15H17N3O4
and a molecular weight of 303.32 g/mol. Its IUPAC name is N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 24981267 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide |
| SMILES | COc1cccc(NC(=O)CN(C)C(=O)c2cc(C)on2)c1 |
| InChI | InChI=1S/C15H17N3O4/c1-10-7-13(17-22-10)15(20)18(2)9-14(19)16-11-5-4-6-12(8-11)21-3/h4-8H,9H2,1-3H3,(H,16,19) |
| InChIKey | QYVOHNVBHCDJRO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide (CID 24981267) is N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide is COc1cccc(NC(=O)CN(C)C(=O)c2cc(C)on2)c1.
What is the InChIKey of N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide?
The InChIKey is QYVOHNVBHCDJRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O4/c1-10-7-13(17-22-10)15(20)18(2)9-14(19)16-11-5-4-6-12(8-11)21-3/h4-8H,9H2,1-3H3,(H,16,19).
What are the key properties of N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide?
N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide has a molecular weight of 303.32 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3-methoxyanilino)-2-oxoethyl]-N,5-dimethyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 24981267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).