About [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate (PubChem CID 24981312) has the molecular formula C15H16F3NO6S
and a molecular weight of 395.36 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate |
| PubChem CID | 24981312 |
| Molecular Formula | C15H16F3NO6S |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate |
| SMILES | O=C(COC(=O)COc1cccc(C(F)(F)F)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H16F3NO6S/c16-15(17,18)10-2-1-3-12(6-10)24-8-14(21)25-7-13(20)19-11-4-5-26(22,23)9-11/h1-3,6,11H,4-5,7-9H2,(H,19,20) |
| InChIKey | ICVZVKZQTQGVPY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate?
The IUPAC name of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate (CID 24981312) is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate.
What is the SMILES notation for [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate?
The canonical SMILES for [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate is O=C(COC(=O)COc1cccc(C(F)(F)F)c1)NC1CCS(=O)(=O)C1.
What is the InChIKey of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate?
The InChIKey is ICVZVKZQTQGVPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F3NO6S/c16-15(17,18)10-2-1-3-12(6-10)24-8-14(21)25-7-13(20)19-11-4-5-26(22,23)9-11/h1-3,6,11H,4-5,7-9H2,(H,19,20).
What are the key properties of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate?
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate has a molecular weight of 395.36 g/mol, XLogP of 0.93, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate is sourced from PubChem (CID 24981312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).