C26H28N2O4 — CID 24981357
methyl (3aR,4S,9aS,9bS)-2-ethyl-1,3-dioxo-4-(4-phenylphenyl)-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate (PubChem CID 24981357) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is methyl (3aR,4S,9aS,9bS)-2-ethyl-1,3-dioxo-4-(4-phenylphenyl)-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate.
| Compound Name | methyl (3aR,4S,9aS,9bS)-2-ethyl-1,3-dioxo-4-(4-phenylphenyl)-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate |
|---|---|
| PubChem CID | 24981357 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | methyl (3aR,4S,9aS,9bS)-2-ethyl-1,3-dioxo-4-(4-phenylphenyl)-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate |
| SMILES | CCN1C(=O)[C@H]2[C@@H](c3ccc(-c4ccccc4)cc3)N3CCCC[C@@]3(C(=O)OC)[C@H]2C1=O |
| InChI | InChI=1S/C26H28N2O4/c1-3-27-23(29)20-21(24(27)30)26(25(31)32-2)15-7-8-16-28(26)22(20)19-13-11-18(12-14-19)17-9-5-4-6-10-17/h4-6,9-14,20-22H,3,7-8,15-16H2,1-2H3/t20-,21-,22-,26+/m1/s1 |
| InChIKey | NDRABLCEBRWUEQ-BILGYAHESA-N |
| XLogP | 3.43 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|