C29H31F3N2O7 — CID 24981360
methyl (3aR,4S,9aS,9bS)-2-ethyl-4-[4-(4-methoxyphenyl)phenyl]-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 24981360) has the molecular formula C29H31F3N2O7 and a molecular weight of 576.57 g/mol. Its IUPAC name is methyl (3aR,4S,9aS,9bS)-2-ethyl-4-[4-(4-methoxyphenyl)phenyl]-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (3aR,4S,9aS,9bS)-2-ethyl-4-[4-(4-methoxyphenyl)phenyl]-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24981360 |
| Molecular Formula | C29H31F3N2O7 |
| Molecular Weight | 576.57 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | methyl (3aR,4S,9aS,9bS)-2-ethyl-4-[4-(4-methoxyphenyl)phenyl]-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCN1C(=O)[C@H]2[C@@H](c3ccc(-c4ccc(OC)cc4)cc3)N3CCCC[C@@]3(C(=O)OC)[C@H]2C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H30N2O5.C2HF3O2/c1-4-28-24(30)21-22(25(28)31)27(26(32)34-3)15-5-6-16-29(27)23(21)19-9-7-17(8-10-19)18-11-13-20(33-2)14-12-18;3-2(4,5)1(6)7/h7-14,21-23H,4-6,15-16H2,1-3H3;(H,6,7)/t21-,22-,23-,27+;/m1./s1 |
| InChIKey | BMXSDQHHWSIVSU-XYDQHSOESA-N |
| XLogP | 4.07 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|