C27H27F3N2O6 — CID 24981382
methyl (3aS,4S,9aS,9bR)-2-methyl-1,3-dioxo-4-(4-phenylphenyl)-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 24981382) has the molecular formula C27H27F3N2O6 and a molecular weight of 532.52 g/mol. Its IUPAC name is methyl (3aS,4S,9aS,9bR)-2-methyl-1,3-dioxo-4-(4-phenylphenyl)-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (3aS,4S,9aS,9bR)-2-methyl-1,3-dioxo-4-(4-phenylphenyl)-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24981382 |
| Molecular Formula | C27H27F3N2O6 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | methyl (3aS,4S,9aS,9bR)-2-methyl-1,3-dioxo-4-(4-phenylphenyl)-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)[C@@]12CCCCN1[C@H](c1ccc(-c3ccccc3)cc1)[C@H]1C(=O)N(C)C(=O)[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H26N2O4.C2HF3O2/c1-26-22(28)19-20(23(26)29)25(24(30)31-2)14-6-7-15-27(25)21(19)18-12-10-17(11-13-18)16-8-4-3-5-9-16;3-2(4,5)1(6)7/h3-5,8-13,19-21H,6-7,14-15H2,1-2H3;(H,6,7)/t19-,20-,21+,25-;/m0./s1 |
| InChIKey | GWNYHVZKQBMLEY-MNRJGUIWSA-N |
| XLogP | 3.67 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|