C26H28N2O5 — CID 24981393
methyl (3aS,4S,9aS,9bR)-4-[4-(4-methoxyphenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate (PubChem CID 24981393) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is methyl (3aS,4S,9aS,9bR)-4-[4-(4-methoxyphenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate.
| Compound Name | methyl (3aS,4S,9aS,9bR)-4-[4-(4-methoxyphenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate |
|---|---|
| PubChem CID | 24981393 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | methyl (3aS,4S,9aS,9bR)-4-[4-(4-methoxyphenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate |
| SMILES | COC(=O)[C@@]12CCCCN1[C@H](c1ccc(-c3ccc(OC)cc3)cc1)[C@H]1C(=O)N(C)C(=O)[C@H]12 |
| InChI | InChI=1S/C26H28N2O5/c1-27-23(29)20-21(24(27)30)26(25(31)33-3)14-4-5-15-28(26)22(20)18-8-6-16(7-9-18)17-10-12-19(32-2)13-11-17/h6-13,20-22H,4-5,14-15H2,1-3H3/t20-,21-,22+,26-/m0/s1 |
| InChIKey | RSRRGCZHLBYBFX-IFOBJOEFSA-N |
| XLogP | 3.05 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|