C27H30N2O5 — CID 24981417
methyl (3aS,4S,9aS,9bR)-2-ethyl-4-[4-(4-methoxyphenyl)phenyl]-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate (PubChem CID 24981417) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is methyl (3aS,4S,9aS,9bR)-2-ethyl-4-[4-(4-methoxyphenyl)phenyl]-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate.
| Compound Name | methyl (3aS,4S,9aS,9bR)-2-ethyl-4-[4-(4-methoxyphenyl)phenyl]-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate |
|---|---|
| PubChem CID | 24981417 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | methyl (3aS,4S,9aS,9bR)-2-ethyl-4-[4-(4-methoxyphenyl)phenyl]-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate |
| SMILES | CCN1C(=O)[C@@H]2[C@@H](c3ccc(-c4ccc(OC)cc4)cc3)N3CCCC[C@@]3(C(=O)OC)[C@@H]2C1=O |
| InChI | InChI=1S/C27H30N2O5/c1-4-28-24(30)21-22(25(28)31)27(26(32)34-3)15-5-6-16-29(27)23(21)19-9-7-17(8-10-19)18-11-13-20(33-2)14-12-18/h7-14,21-23H,4-6,15-16H2,1-3H3/t21-,22-,23+,27-/m0/s1 |
| InChIKey | LFCARCXHJMRREQ-TZKYFUQOSA-N |
| XLogP | 3.44 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|