C28H29F3N2O7 — CID 24981460
methyl (3aR,4S,9aS,9bS)-4-[4-(4-methoxyphenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 24981460) has the molecular formula C28H29F3N2O7 and a molecular weight of 562.54 g/mol. Its IUPAC name is methyl (3aR,4S,9aS,9bS)-4-[4-(4-methoxyphenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (3aR,4S,9aS,9bS)-4-[4-(4-methoxyphenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24981460 |
| Molecular Formula | C28H29F3N2O7 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | methyl (3aR,4S,9aS,9bS)-4-[4-(4-methoxyphenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)[C@@]12CCCCN1[C@H](c1ccc(-c3ccc(OC)cc3)cc1)[C@@H]1C(=O)N(C)C(=O)[C@@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H28N2O5.C2HF3O2/c1-27-23(29)20-21(24(27)30)26(25(31)33-3)14-4-5-15-28(26)22(20)18-8-6-16(7-9-18)17-10-12-19(32-2)13-11-17;3-2(4,5)1(6)7/h6-13,20-22H,4-5,14-15H2,1-3H3;(H,6,7)/t20-,21-,22-,26+;/m1./s1 |
| InChIKey | ZVBSGIHVUFJFQC-CPNWZACFSA-N |
| XLogP | 3.68 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|