C27H26F4N2O6 — CID 24981464
methyl (3aR,4S,9aS,9bS)-4-[4-(4-fluorophenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 24981464) has the molecular formula C27H26F4N2O6 and a molecular weight of 550.51 g/mol. Its IUPAC name is methyl (3aR,4S,9aS,9bS)-4-[4-(4-fluorophenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (3aR,4S,9aS,9bS)-4-[4-(4-fluorophenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24981464 |
| Molecular Formula | C27H26F4N2O6 |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | methyl (3aR,4S,9aS,9bS)-4-[4-(4-fluorophenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)[C@@]12CCCCN1[C@H](c1ccc(-c3ccc(F)cc3)cc1)[C@@H]1C(=O)N(C)C(=O)[C@@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H25FN2O4.C2HF3O2/c1-27-22(29)19-20(23(27)30)25(24(31)32-2)13-3-4-14-28(25)21(19)17-7-5-15(6-8-17)16-9-11-18(26)12-10-16;3-2(4,5)1(6)7/h5-12,19-21H,3-4,13-14H2,1-2H3;(H,6,7)/t19-,20-,21-,25+;/m1./s1 |
| InChIKey | RDEFIXBEAVMDIQ-BJWSJTOGSA-N |
| XLogP | 3.81 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|