C25H32N2O4S — CID 24981467
methyl (3aR,4S,9aS,9bS)-4-(4-cyclohexylsulfanylphenyl)-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate (PubChem CID 24981467) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is methyl (3aR,4S,9aS,9bS)-4-(4-cyclohexylsulfanylphenyl)-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate.
| Compound Name | methyl (3aR,4S,9aS,9bS)-4-(4-cyclohexylsulfanylphenyl)-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate |
|---|---|
| PubChem CID | 24981467 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | methyl (3aR,4S,9aS,9bS)-4-(4-cyclohexylsulfanylphenyl)-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate |
| SMILES | COC(=O)[C@@]12CCCCN1[C@H](c1ccc(SC3CCCCC3)cc1)[C@@H]1C(=O)N(C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C25H32N2O4S/c1-26-22(28)19-20(23(26)29)25(24(30)31-2)14-6-7-15-27(25)21(19)16-10-12-18(13-11-16)32-17-8-4-3-5-9-17/h10-13,17,19-21H,3-9,14-15H2,1-2H3/t19-,20-,21-,25+/m1/s1 |
| InChIKey | YMWIKLLMUXSHKT-YCFYUYSTSA-N |
| XLogP | 3.79 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|