C30H31F3N2O7 — CID 24981474
methyl (3aR,4S,9aS,9bS)-4-[4-(4-acetylphenyl)phenyl]-2-ethyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 24981474) has the molecular formula C30H31F3N2O7 and a molecular weight of 588.58 g/mol. Its IUPAC name is methyl (3aR,4S,9aS,9bS)-4-[4-(4-acetylphenyl)phenyl]-2-ethyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (3aR,4S,9aS,9bS)-4-[4-(4-acetylphenyl)phenyl]-2-ethyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24981474 |
| Molecular Formula | C30H31F3N2O7 |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | methyl (3aR,4S,9aS,9bS)-4-[4-(4-acetylphenyl)phenyl]-2-ethyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCN1C(=O)[C@H]2[C@@H](c3ccc(-c4ccc(C(C)=O)cc4)cc3)N3CCCC[C@@]3(C(=O)OC)[C@H]2C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H30N2O5.C2HF3O2/c1-4-29-25(32)22-23(26(29)33)28(27(34)35-3)15-5-6-16-30(28)24(22)21-13-11-20(12-14-21)19-9-7-18(8-10-19)17(2)31;3-2(4,5)1(6)7/h7-14,22-24H,4-6,15-16H2,1-3H3;(H,6,7)/t22-,23-,24-,28+;/m1./s1 |
| InChIKey | SFFJQBGQBRSSNJ-DQYCJXAYSA-N |
| XLogP | 4.26 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|