About N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide
N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide (PubChem CID 24981645) has the molecular formula C24H22FN3O3S
and a molecular weight of 451.52 g/mol. Its IUPAC name is N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide |
| PubChem CID | 24981645 |
| Molecular Formula | C24H22FN3O3S |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide |
| SMILES | CC(=O)c1sc(NC(=O)C2CCN(C(=O)c3ccc(F)cc3)CC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H22FN3O3S/c1-15(29)21-20(16-5-3-2-4-6-16)26-24(32-21)27-22(30)17-11-13-28(14-12-17)23(31)18-7-9-19(25)10-8-18/h2-10,17H,11-14H2,1H3,(H,26,27,30) |
| InChIKey | DDOXGWVVIBABQS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide?
The IUPAC name of N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide (CID 24981645) is N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide.
What is the SMILES notation for N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide?
The canonical SMILES for N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide is CC(=O)c1sc(NC(=O)C2CCN(C(=O)c3ccc(F)cc3)CC2)nc1-c1ccccc1.
What is the InChIKey of N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide?
The InChIKey is DDOXGWVVIBABQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22FN3O3S/c1-15(29)21-20(16-5-3-2-4-6-16)26-24(32-21)27-22(30)17-11-13-28(14-12-17)23(31)18-7-9-19(25)10-8-18/h2-10,17H,11-14H2,1H3,(H,26,27,30).
What are the key properties of N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide?
N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide has a molecular weight of 451.52 g/mol, XLogP of 4.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide is sourced from PubChem (CID 24981645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).