About [4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone
[4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone (PubChem CID 24981653) has the molecular formula C21H23NO2
and a molecular weight of 321.42 g/mol. Its IUPAC name is [4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone |
| PubChem CID | 24981653 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | [4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone |
| SMILES | CC1CC(C)CN(C(=O)c2ccc(C(=O)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C21H23NO2/c1-15-12-16(2)14-22(13-15)21(24)19-10-8-18(9-11-19)20(23)17-6-4-3-5-7-17/h3-11,15-16H,12-14H2,1-2H3 |
| InChIKey | INNBUMMWGMJGSG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone?
The IUPAC name of [4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone (CID 24981653) is [4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone.
What is the SMILES notation for [4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone?
The canonical SMILES for [4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone is CC1CC(C)CN(C(=O)c2ccc(C(=O)c3ccccc3)cc2)C1.
What is the InChIKey of [4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone?
The InChIKey is INNBUMMWGMJGSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO2/c1-15-12-16(2)14-22(13-15)21(24)19-10-8-18(9-11-19)20(23)17-6-4-3-5-7-17/h3-11,15-16H,12-14H2,1-2H3.
What are the key properties of [4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone?
[4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone has a molecular weight of 321.42 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-phenylmethanone is sourced from PubChem (CID 24981653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).