About 2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate
2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate (PubChem CID 2498174) has the molecular formula C20H19BrN2O6S
and a molecular weight of 495.35 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate |
| PubChem CID | 2498174 |
| Molecular Formula | C20H19BrN2O6S |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate |
| SMILES | CC(C)NS(=O)(=O)c1ccc(Br)c(C(=O)OCCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C20H19BrN2O6S/c1-12(2)22-30(27,28)13-7-8-17(21)16(11-13)20(26)29-10-9-23-18(24)14-5-3-4-6-15(14)19(23)25/h3-8,11-12,22H,9-10H2,1-2H3 |
| InChIKey | YEYUHFRMTZYJKG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate?
The IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate (CID 2498174) is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate.
What is the SMILES notation for 2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate?
The canonical SMILES for 2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate is CC(C)NS(=O)(=O)c1ccc(Br)c(C(=O)OCCN2C(=O)c3ccccc3C2=O)c1.
What is the InChIKey of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate?
The InChIKey is YEYUHFRMTZYJKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19BrN2O6S/c1-12(2)22-30(27,28)13-7-8-17(21)16(11-13)20(26)29-10-9-23-18(24)14-5-3-4-6-15(14)19(23)25/h3-8,11-12,22H,9-10H2,1-2H3.
What are the key properties of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate?
2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate has a molecular weight of 495.35 g/mol, XLogP of 2.59, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxoisoindol-2-yl)ethyl 2-bromo-5-(propan-2-ylsulfamoyl)benzoate is sourced from PubChem (CID 2498174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).