C22H21F3N4O4S — CID 24981770
N-methyl-5,5-dioxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide (PubChem CID 24981770) has the molecular formula C22H21F3N4O4S and a molecular weight of 494.50 g/mol. Its IUPAC name is N-methyl-5,5-dioxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide.
| Compound Name | N-methyl-5,5-dioxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 24981770 |
| Molecular Formula | C22H21F3N4O4S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-methyl-5,5-dioxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1ccc2c(c1)S(=O)(=O)N=C1CCCCCN12 |
| InChI | InChI=1S/C22H21F3N4O4S/c1-28(12-19(30)26-15-8-7-14(23)20(24)21(15)25)22(31)13-6-9-16-17(11-13)34(32,33)27-18-5-3-2-4-10-29(16)18/h6-9,11H,2-5,10,12H2,1H3,(H,26,30) |
| InChIKey | CCMWFZVCWDSKGR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|