About [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate
[2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate (PubChem CID 24981951) has the molecular formula C19H22N2O5S2
and a molecular weight of 422.53 g/mol. Its IUPAC name is [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate.
Molecular Properties
| Compound Name | [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate |
| PubChem CID | 24981951 |
| Molecular Formula | C19H22N2O5S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)COC(=O)CSc1ccccc1 |
| InChI | InChI=1S/C19H22N2O5S2/c1-14-9-10-16(28(24,25)21(2)3)11-17(14)20-18(22)12-26-19(23)13-27-15-7-5-4-6-8-15/h4-11H,12-13H2,1-3H3,(H,20,22) |
| InChIKey | BKAPZXULQBAFTC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate?
The IUPAC name of [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate (CID 24981951) is [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate.
What is the SMILES notation for [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate?
The canonical SMILES for [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate is Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)COC(=O)CSc1ccccc1.
What is the InChIKey of [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate?
The InChIKey is BKAPZXULQBAFTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O5S2/c1-14-9-10-16(28(24,25)21(2)3)11-17(14)20-18(22)12-26-19(23)13-27-15-7-5-4-6-8-15/h4-11H,12-13H2,1-3H3,(H,20,22).
What are the key properties of [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate?
[2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate has a molecular weight of 422.53 g/mol, XLogP of 2.52, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 2-phenylsulfanylacetate is sourced from PubChem (CID 24981951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).