C22H20N4O3S2 — CID 2498201
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide (PubChem CID 2498201) has the molecular formula C22H20N4O3S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2498201 |
| Molecular Formula | C22H20N4O3S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C22H20N4O3S2/c27-17(23-11-12-26-18(28)14-31-22(26)29)13-30-21-24-19(15-7-3-1-4-8-15)20(25-21)16-9-5-2-6-10-16/h1-10H,11-14H2,(H,23,27)(H,24,25) |
| InChIKey | JEPLLFQAJUMBQL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|