About [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate (PubChem CID 24982025) has the molecular formula C14H12ClN3O6S
and a molecular weight of 385.79 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate.
Molecular Properties
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate |
| PubChem CID | 24982025 |
| Molecular Formula | C14H12ClN3O6S |
| Molecular Weight | 385.79 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate |
| SMILES | Cc1csc(=O)n1CC(=O)OCC(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C14H12ClN3O6S/c1-8-7-25-14(21)17(8)5-13(20)24-6-12(19)16-11-4-9(18(22)23)2-3-10(11)15/h2-4,7H,5-6H2,1H3,(H,16,19) |
| InChIKey | VPZWQHHBIUJJOV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.79 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate?
The IUPAC name of [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate (CID 24982025) is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate.
What is the SMILES notation for [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate?
The canonical SMILES for [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate is Cc1csc(=O)n1CC(=O)OCC(=O)Nc1cc([N+](=O)[O-])ccc1Cl.
What is the InChIKey of [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate?
The InChIKey is VPZWQHHBIUJJOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClN3O6S/c1-8-7-25-14(21)17(8)5-13(20)24-6-12(19)16-11-4-9(18(22)23)2-3-10(11)15/h2-4,7H,5-6H2,1H3,(H,16,19).
What are the key properties of [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate?
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate has a molecular weight of 385.79 g/mol, XLogP of 1.96, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate is sourced from PubChem (CID 24982025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).