C18H20N2O5 — CID 24982111
(1-oxo-1-phenylpropan-2-yl) 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 24982111) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 24982111 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | CC(OC(=O)CN1C(=O)NC2(CCCC2)C1=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O5/c1-12(15(22)13-7-3-2-4-8-13)25-14(21)11-20-16(23)18(19-17(20)24)9-5-6-10-18/h2-4,7-8,12H,5-6,9-11H2,1H3,(H,19,24) |
| InChIKey | TVQSYBSMLGBWPN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|