C13H22O6 — CID 24982139
(E,6R)-6-[(2R,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoic acid (PubChem CID 24982139) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is (E,6R)-6-[(2R,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoic acid.
| Compound Name | (E,6R)-6-[(2R,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoic acid |
|---|---|
| PubChem CID | 24982139 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (E,6R)-6-[(2R,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoic acid |
| SMILES | CC1O[C@@H](O[C@H](C)CC/C=C/C(=O)O)C(O)C[C@H]1O |
| InChI | InChI=1S/C13H22O6/c1-8(5-3-4-6-12(16)17)18-13-11(15)7-10(14)9(2)19-13/h4,6,8-11,13-15H,3,5,7H2,1-2H3,(H,16,17)/b6-4+/t8-,9?,10-,11?,13-/m1/s1 |
| InChIKey | GGHOMCWJOMBZEK-DKGNOPGWSA-N |
| XLogP | 0.67 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|